About 6-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonylamino]hexanoic acid
6-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonylamino]hexanoic acid (PubChem CID 28783650) has the molecular formula C11H18N2O5S
and a molecular weight of 290.34 g/mol. Its IUPAC name is 6-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonylamino]hexanoic acid.
Molecular Properties
| Compound Name | 6-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonylamino]hexanoic acid |
| PubChem CID | 28783650 |
| Molecular Formula | C11H18N2O5S |
| Molecular Weight | 290.34 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | 6-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonylamino]hexanoic acid |
| SMILES | Cc1noc(C)c1S(=O)(=O)NCCCCCC(=O)O |
| InChI | InChI=1S/C11H18N2O5S/c1-8-11(9(2)18-13-8)19(16,17)12-7-5-3-4-6-10(14)15/h12H,3-7H2,1-2H3,(H,14,15) |
| InChIKey | SFSDPSDZCZBLTM-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 109.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.34 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonylamino]hexanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonylamino]hexanoic acid?
The IUPAC name of 6-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonylamino]hexanoic acid (CID 28783650) is 6-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonylamino]hexanoic acid.
What is the SMILES notation for 6-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonylamino]hexanoic acid?
The canonical SMILES for 6-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonylamino]hexanoic acid is Cc1noc(C)c1S(=O)(=O)NCCCCCC(=O)O.
What is the InChIKey of 6-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonylamino]hexanoic acid?
The InChIKey is SFSDPSDZCZBLTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N2O5S/c1-8-11(9(2)18-13-8)19(16,17)12-7-5-3-4-6-10(14)15/h12H,3-7H2,1-2H3,(H,14,15).
What are the key properties of 6-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonylamino]hexanoic acid?
6-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonylamino]hexanoic acid has a molecular weight of 290.34 g/mol, XLogP of 1.21, 8 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonylamino]hexanoic acid is sourced from PubChem (CID 28783650), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).