C16H24N4O2S — CID 2878808
1-(4-nitrophenyl)-3-(2,2,6,6-tetramethylpiperidin-4-yl)thiourea (PubChem CID 2878808) has the molecular formula C16H24N4O2S and a molecular weight of 336.46 g/mol. Its IUPAC name is 1-(4-nitrophenyl)-3-(2,2,6,6-tetramethylpiperidin-4-yl)thiourea.
| Compound Name | 1-(4-nitrophenyl)-3-(2,2,6,6-tetramethylpiperidin-4-yl)thiourea |
|---|---|
| PubChem CID | 2878808 |
| Molecular Formula | C16H24N4O2S |
| Molecular Weight | 336.46 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | 1-(4-nitrophenyl)-3-(2,2,6,6-tetramethylpiperidin-4-yl)thiourea |
| SMILES | CC1(C)CC(NC(=S)Nc2ccc([N+](=O)[O-])cc2)CC(C)(C)N1 |
| InChI | InChI=1S/C16H24N4O2S/c1-15(2)9-12(10-16(3,4)19-15)18-14(23)17-11-5-7-13(8-6-11)20(21)22/h5-8,12,19H,9-10H2,1-4H3,(H2,17,18,23) |
| InChIKey | OIJBQXGZUNVIRM-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 79.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.46 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|