C11H17N3O — CID 28788625
(1,5-dimethylpyrrol-2-yl)-piperazin-1-ylmethanone (PubChem CID 28788625) has the molecular formula C11H17N3O and a molecular weight of 207.28 g/mol. Its IUPAC name is (1,5-dimethylpyrrol-2-yl)-piperazin-1-ylmethanone.
| Compound Name | (1,5-dimethylpyrrol-2-yl)-piperazin-1-ylmethanone |
|---|---|
| PubChem CID | 28788625 |
| Molecular Formula | C11H17N3O |
| Molecular Weight | 207.28 g/mol |
| Exact Mass | 207.14 |
| IUPAC Name | (1,5-dimethylpyrrol-2-yl)-piperazin-1-ylmethanone |
| SMILES | Cc1ccc(C(=O)N2CCNCC2)n1C |
| InChI | InChI=1S/C11H17N3O/c1-9-3-4-10(13(9)2)11(15)14-7-5-12-6-8-14/h3-4,12H,5-8H2,1-2H3 |
| InChIKey | FZNAGSOYIAEFME-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.28 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |