About 2,6-bis(4-chlorophenyl)-3,5-dimethylpiperidin-4-one
2,6-bis(4-chlorophenyl)-3,5-dimethylpiperidin-4-one (PubChem CID 2878950) has the molecular formula C19H19Cl2NO
and a molecular weight of 348.27 g/mol. Its IUPAC name is 2,6-bis(4-chlorophenyl)-3,5-dimethylpiperidin-4-one.
Molecular Properties
| Compound Name | 2,6-bis(4-chlorophenyl)-3,5-dimethylpiperidin-4-one |
| PubChem CID | 2878950 |
| Molecular Formula | C19H19Cl2NO |
| Molecular Weight | 348.27 g/mol |
| Exact Mass | 347.08 |
| IUPAC Name | 2,6-bis(4-chlorophenyl)-3,5-dimethylpiperidin-4-one |
| SMILES | CC1C(=O)C(C)C(c2ccc(Cl)cc2)NC1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H19Cl2NO/c1-11-17(13-3-7-15(20)8-4-13)22-18(12(2)19(11)23)14-5-9-16(21)10-6-14/h3-12,17-18,22H,1-2H3 |
| InChIKey | HZJRRCMQPKSHRC-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 348.27 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,6-bis(4-chlorophenyl)-3,5-dimethylpiperidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-bis(4-chlorophenyl)-3,5-dimethylpiperidin-4-one?
The IUPAC name of 2,6-bis(4-chlorophenyl)-3,5-dimethylpiperidin-4-one (CID 2878950) is 2,6-bis(4-chlorophenyl)-3,5-dimethylpiperidin-4-one.
What is the SMILES notation for 2,6-bis(4-chlorophenyl)-3,5-dimethylpiperidin-4-one?
The canonical SMILES for 2,6-bis(4-chlorophenyl)-3,5-dimethylpiperidin-4-one is CC1C(=O)C(C)C(c2ccc(Cl)cc2)NC1c1ccc(Cl)cc1.
What is the InChIKey of 2,6-bis(4-chlorophenyl)-3,5-dimethylpiperidin-4-one?
The InChIKey is HZJRRCMQPKSHRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19Cl2NO/c1-11-17(13-3-7-15(20)8-4-13)22-18(12(2)19(11)23)14-5-9-16(21)10-6-14/h3-12,17-18,22H,1-2H3.
What are the key properties of 2,6-bis(4-chlorophenyl)-3,5-dimethylpiperidin-4-one?
2,6-bis(4-chlorophenyl)-3,5-dimethylpiperidin-4-one has a molecular weight of 348.27 g/mol, XLogP of 5.22, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-bis(4-chlorophenyl)-3,5-dimethylpiperidin-4-one is sourced from PubChem (CID 2878950), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).