About (3S)-1-(2-oxo-1,3-dihydroimidazole-4-carbonyl)piperidine-3-carboxylic acid
(3S)-1-(2-oxo-1,3-dihydroimidazole-4-carbonyl)piperidine-3-carboxylic acid (PubChem CID 28789828) has the molecular formula C10H13N3O4
and a molecular weight of 239.23 g/mol. Its IUPAC name is (3S)-1-(2-oxo-1,3-dihydroimidazole-4-carbonyl)piperidine-3-carboxylic acid.
Molecular Properties
| Compound Name | (3S)-1-(2-oxo-1,3-dihydroimidazole-4-carbonyl)piperidine-3-carboxylic acid |
| PubChem CID | 28789828 |
| Molecular Formula | C10H13N3O4 |
| Molecular Weight | 239.23 g/mol |
| Exact Mass | 239.09 |
| IUPAC Name | (3S)-1-(2-oxo-1,3-dihydroimidazole-4-carbonyl)piperidine-3-carboxylic acid |
| SMILES | O=C(O)[C@H]1CCCN(C(=O)c2c[nH]c(=O)[nH]2)C1 |
| InChI | InChI=1S/C10H13N3O4/c14-8(7-4-11-10(17)12-7)13-3-1-2-6(5-13)9(15)16/h4,6H,1-3,5H2,(H,15,16)(H2,11,12,17)/t6-/m0/s1 |
| InChIKey | DHVBLTTYVLLNJT-LURJTMIESA-N |
| XLogP | -0.36 |
| TPSA | 106.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.23 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3S)-1-(2-oxo-1,3-dihydroimidazole-4-carbonyl)piperidine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-1-(2-oxo-1,3-dihydroimidazole-4-carbonyl)piperidine-3-carboxylic acid?
The IUPAC name of (3S)-1-(2-oxo-1,3-dihydroimidazole-4-carbonyl)piperidine-3-carboxylic acid (CID 28789828) is (3S)-1-(2-oxo-1,3-dihydroimidazole-4-carbonyl)piperidine-3-carboxylic acid.
What is the SMILES notation for (3S)-1-(2-oxo-1,3-dihydroimidazole-4-carbonyl)piperidine-3-carboxylic acid?
The canonical SMILES for (3S)-1-(2-oxo-1,3-dihydroimidazole-4-carbonyl)piperidine-3-carboxylic acid is O=C(O)[C@H]1CCCN(C(=O)c2c[nH]c(=O)[nH]2)C1.
What is the InChIKey of (3S)-1-(2-oxo-1,3-dihydroimidazole-4-carbonyl)piperidine-3-carboxylic acid?
The InChIKey is DHVBLTTYVLLNJT-LURJTMIESA-N. The full InChI is InChI=1S/C10H13N3O4/c14-8(7-4-11-10(17)12-7)13-3-1-2-6(5-13)9(15)16/h4,6H,1-3,5H2,(H,15,16)(H2,11,12,17)/t6-/m0/s1.
What are the key properties of (3S)-1-(2-oxo-1,3-dihydroimidazole-4-carbonyl)piperidine-3-carboxylic acid?
(3S)-1-(2-oxo-1,3-dihydroimidazole-4-carbonyl)piperidine-3-carboxylic acid has a molecular weight of 239.23 g/mol, XLogP of -0.36, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-1-(2-oxo-1,3-dihydroimidazole-4-carbonyl)piperidine-3-carboxylic acid is sourced from PubChem (CID 28789828), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).