About (2R)-1-[(2S)-2-(1,2,4-triazol-1-yl)propanoyl]piperidine-2-carboxylic acid
(2R)-1-[(2S)-2-(1,2,4-triazol-1-yl)propanoyl]piperidine-2-carboxylic acid (PubChem CID 28789892) has the molecular formula C11H16N4O3
and a molecular weight of 252.27 g/mol. Its IUPAC name is (2R)-1-[(2S)-2-(1,2,4-triazol-1-yl)propanoyl]piperidine-2-carboxylic acid.
Molecular Properties
| Compound Name | (2R)-1-[(2S)-2-(1,2,4-triazol-1-yl)propanoyl]piperidine-2-carboxylic acid |
| PubChem CID | 28789892 |
| Molecular Formula | C11H16N4O3 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.12 |
| IUPAC Name | (2R)-1-[(2S)-2-(1,2,4-triazol-1-yl)propanoyl]piperidine-2-carboxylic acid |
| SMILES | C[C@@H](C(=O)N1CCCC[C@@H]1C(=O)O)n1cncn1 |
| InChI | InChI=1S/C11H16N4O3/c1-8(15-7-12-6-13-15)10(16)14-5-3-2-4-9(14)11(17)18/h6-9H,2-5H2,1H3,(H,17,18)/t8-,9+/m0/s1 |
| InChIKey | HGZVCSKNKZNFBY-DTWKUNHWSA-N |
| XLogP | 0.30 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2R)-1-[(2S)-2-(1,2,4-triazol-1-yl)propanoyl]piperidine-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-1-[(2S)-2-(1,2,4-triazol-1-yl)propanoyl]piperidine-2-carboxylic acid?
The IUPAC name of (2R)-1-[(2S)-2-(1,2,4-triazol-1-yl)propanoyl]piperidine-2-carboxylic acid (CID 28789892) is (2R)-1-[(2S)-2-(1,2,4-triazol-1-yl)propanoyl]piperidine-2-carboxylic acid.
What is the SMILES notation for (2R)-1-[(2S)-2-(1,2,4-triazol-1-yl)propanoyl]piperidine-2-carboxylic acid?
The canonical SMILES for (2R)-1-[(2S)-2-(1,2,4-triazol-1-yl)propanoyl]piperidine-2-carboxylic acid is C[C@@H](C(=O)N1CCCC[C@@H]1C(=O)O)n1cncn1.
What is the InChIKey of (2R)-1-[(2S)-2-(1,2,4-triazol-1-yl)propanoyl]piperidine-2-carboxylic acid?
The InChIKey is HGZVCSKNKZNFBY-DTWKUNHWSA-N. The full InChI is InChI=1S/C11H16N4O3/c1-8(15-7-12-6-13-15)10(16)14-5-3-2-4-9(14)11(17)18/h6-9H,2-5H2,1H3,(H,17,18)/t8-,9+/m0/s1.
What are the key properties of (2R)-1-[(2S)-2-(1,2,4-triazol-1-yl)propanoyl]piperidine-2-carboxylic acid?
(2R)-1-[(2S)-2-(1,2,4-triazol-1-yl)propanoyl]piperidine-2-carboxylic acid has a molecular weight of 252.27 g/mol, XLogP of 0.30, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-1-[(2S)-2-(1,2,4-triazol-1-yl)propanoyl]piperidine-2-carboxylic acid is sourced from PubChem (CID 28789892), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).