C11H17N3O3 — CID 28790075
(2S,3S)-3-methyl-2-[(2-pyrazol-1-ylacetyl)amino]pentanoic acid (PubChem CID 28790075) has the molecular formula C11H17N3O3 and a molecular weight of 239.27 g/mol. Its IUPAC name is (2S,3S)-3-methyl-2-[(2-pyrazol-1-ylacetyl)amino]pentanoic acid.
| Compound Name | (2S,3S)-3-methyl-2-[(2-pyrazol-1-ylacetyl)amino]pentanoic acid |
|---|---|
| PubChem CID | 28790075 |
| Molecular Formula | C11H17N3O3 |
| Molecular Weight | 239.27 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | (2S,3S)-3-methyl-2-[(2-pyrazol-1-ylacetyl)amino]pentanoic acid |
| SMILES | CC[C@H](C)[C@H](NC(=O)Cn1cccn1)C(=O)O |
| InChI | InChI=1S/C11H17N3O3/c1-3-8(2)10(11(16)17)13-9(15)7-14-6-4-5-12-14/h4-6,8,10H,3,7H2,1-2H3,(H,13,15)(H,16,17)/t8-,10-/m0/s1 |
| InChIKey | BAZKHVNPXMKDDU-WPRPVWTQSA-N |
| XLogP | 0.50 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.27 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |