C8H9N3O5 — CID 28790345
(2S)-3-hydroxy-2-[(6-oxo-1H-pyrazine-3-carbonyl)amino]propanoic acid (PubChem CID 28790345) has the molecular formula C8H9N3O5 and a molecular weight of 227.18 g/mol. Its IUPAC name is (2S)-3-hydroxy-2-[(6-oxo-1H-pyrazine-3-carbonyl)amino]propanoic acid.
| Compound Name | (2S)-3-hydroxy-2-[(6-oxo-1H-pyrazine-3-carbonyl)amino]propanoic acid |
|---|---|
| PubChem CID | 28790345 |
| Molecular Formula | C8H9N3O5 |
| Molecular Weight | 227.18 g/mol |
| Exact Mass | 227.05 |
| IUPAC Name | (2S)-3-hydroxy-2-[(6-oxo-1H-pyrazine-3-carbonyl)amino]propanoic acid |
| SMILES | O=C(N[C@@H](CO)C(=O)O)c1c[nH]c(=O)cn1 |
| InChI | InChI=1S/C8H9N3O5/c12-3-5(8(15)16)11-7(14)4-1-10-6(13)2-9-4/h1-2,5,12H,3H2,(H,10,13)(H,11,14)(H,15,16)/t5-/m0/s1 |
| InChIKey | NZOPEYVYWPECMF-YFKPBYRVSA-N |
| XLogP | -2.05 |
| TPSA | 132.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.18 |
| LogP ≤ 5 | -2.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |