C14H13FN2O3 — CID 28791303
2-[(1,5-dimethylpyrrole-2-carbonyl)amino]-5-fluorobenzoic acid (PubChem CID 28791303) has the molecular formula C14H13FN2O3 and a molecular weight of 276.27 g/mol. Its IUPAC name is 2-[(1,5-dimethylpyrrole-2-carbonyl)amino]-5-fluorobenzoic acid.
| Compound Name | 2-[(1,5-dimethylpyrrole-2-carbonyl)amino]-5-fluorobenzoic acid |
|---|---|
| PubChem CID | 28791303 |
| Molecular Formula | C14H13FN2O3 |
| Molecular Weight | 276.27 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | 2-[(1,5-dimethylpyrrole-2-carbonyl)amino]-5-fluorobenzoic acid |
| SMILES | Cc1ccc(C(=O)Nc2ccc(F)cc2C(=O)O)n1C |
| InChI | InChI=1S/C14H13FN2O3/c1-8-3-6-12(17(8)2)13(18)16-11-5-4-9(15)7-10(11)14(19)20/h3-7H,1-2H3,(H,16,18)(H,19,20) |
| InChIKey | GGWLMNIZFANEEO-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 71.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.27 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |