About 3-amino-2-methylpyrido[1,2-a]pyrimidin-4-one;hydrochloride
3-amino-2-methylpyrido[1,2-a]pyrimidin-4-one;hydrochloride (PubChem CID 2879264) has the molecular formula C9H10ClN3O
and a molecular weight of 211.65 g/mol. Its IUPAC name is 3-amino-2-methylpyrido[1,2-a]pyrimidin-4-one;hydrochloride.
Molecular Properties
| Compound Name | 3-amino-2-methylpyrido[1,2-a]pyrimidin-4-one;hydrochloride |
| PubChem CID | 2879264 |
| Molecular Formula | C9H10ClN3O |
| Molecular Weight | 211.65 g/mol |
| Exact Mass | 211.05 |
| IUPAC Name | 3-amino-2-methylpyrido[1,2-a]pyrimidin-4-one;hydrochloride |
| SMILES | Cc1nc2ccccn2c(=O)c1N.Cl |
| InChI | InChI=1S/C9H9N3O.ClH/c1-6-8(10)9(13)12-5-3-2-4-7(12)11-6;/h2-5H,10H2,1H3;1H |
| InChIKey | BHBBZHNNZNYEBA-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 60.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.65 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-amino-2-methylpyrido[1,2-a]pyrimidin-4-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-2-methylpyrido[1,2-a]pyrimidin-4-one;hydrochloride?
The IUPAC name of 3-amino-2-methylpyrido[1,2-a]pyrimidin-4-one;hydrochloride (CID 2879264) is 3-amino-2-methylpyrido[1,2-a]pyrimidin-4-one;hydrochloride.
What is the SMILES notation for 3-amino-2-methylpyrido[1,2-a]pyrimidin-4-one;hydrochloride?
The canonical SMILES for 3-amino-2-methylpyrido[1,2-a]pyrimidin-4-one;hydrochloride is Cc1nc2ccccn2c(=O)c1N.Cl.
What is the InChIKey of 3-amino-2-methylpyrido[1,2-a]pyrimidin-4-one;hydrochloride?
The InChIKey is BHBBZHNNZNYEBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N3O.ClH/c1-6-8(10)9(13)12-5-3-2-4-7(12)11-6;/h2-5H,10H2,1H3;1H.
What are the key properties of 3-amino-2-methylpyrido[1,2-a]pyrimidin-4-one;hydrochloride?
3-amino-2-methylpyrido[1,2-a]pyrimidin-4-one;hydrochloride has a molecular weight of 211.65 g/mol, XLogP of 1.01, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-2-methylpyrido[1,2-a]pyrimidin-4-one;hydrochloride is sourced from PubChem (CID 2879264), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).