C21H22N4O5S — CID 2879271
N,N-diethyl-4-[(6-hydroxy-2,4-dioxo-1-phenylpyrimidin-5-yl)methylideneamino]benzenesulfonamide (PubChem CID 2879271) has the molecular formula C21H22N4O5S and a molecular weight of 442.50 g/mol. Its IUPAC name is N,N-diethyl-4-[(6-hydroxy-2,4-dioxo-1-phenylpyrimidin-5-yl)methylideneamino]benzenesulfonamide.
| Compound Name | N,N-diethyl-4-[(6-hydroxy-2,4-dioxo-1-phenylpyrimidin-5-yl)methylideneamino]benzenesulfonamide |
|---|---|
| PubChem CID | 2879271 |
| Molecular Formula | C21H22N4O5S |
| Molecular Weight | 442.50 g/mol |
| Exact Mass | 442.13 |
| IUPAC Name | N,N-diethyl-4-[(6-hydroxy-2,4-dioxo-1-phenylpyrimidin-5-yl)methylideneamino]benzenesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(/N=C/c2c(O)n(-c3ccccc3)c(=O)[nH]c2=O)cc1 |
| InChI | InChI=1S/C21H22N4O5S/c1-3-24(4-2)31(29,30)17-12-10-15(11-13-17)22-14-18-19(26)23-21(28)25(20(18)27)16-8-6-5-7-9-16/h5-14,27H,3-4H2,1-2H3,(H,23,26,28)/b22-14+ |
| InChIKey | FWIOZXUHBWVKIA-HYARGMPZSA-N |
| XLogP | 2.01 |
| TPSA | 124.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.50 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|