C19H27ClN2O4 — CID 2879308
1-[(3-chlorophenyl)methyl]-4-cyclohexylpiperazine;oxalic acid (PubChem CID 2879308) has the molecular formula C19H27ClN2O4 and a molecular weight of 382.89 g/mol. Its IUPAC name is 1-[(3-chlorophenyl)methyl]-4-cyclohexylpiperazine;oxalic acid.
| Compound Name | 1-[(3-chlorophenyl)methyl]-4-cyclohexylpiperazine;oxalic acid |
|---|---|
| PubChem CID | 2879308 |
| Molecular Formula | C19H27ClN2O4 |
| Molecular Weight | 382.89 g/mol |
| Exact Mass | 382.17 |
| IUPAC Name | 1-[(3-chlorophenyl)methyl]-4-cyclohexylpiperazine;oxalic acid |
| SMILES | Clc1cccc(CN2CCN(C3CCCCC3)CC2)c1.O=C(O)C(=O)O |
| InChI | InChI=1S/C17H25ClN2.C2H2O4/c18-16-6-4-5-15(13-16)14-19-9-11-20(12-10-19)17-7-2-1-3-8-17;3-1(4)2(5)6/h4-6,13,17H,1-3,7-12,14H2;(H,3,4)(H,5,6) |
| InChIKey | NQEDESCBLRJAFV-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.89 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|