C22H30ClNO — CID 2879638
3,4-dimethyl-2,6-diphenyl-5-propylpiperidin-4-ol;hydrochloride (PubChem CID 2879638) has the molecular formula C22H30ClNO and a molecular weight of 359.94 g/mol. Its IUPAC name is 3,4-dimethyl-2,6-diphenyl-5-propylpiperidin-4-ol;hydrochloride.
| Compound Name | 3,4-dimethyl-2,6-diphenyl-5-propylpiperidin-4-ol;hydrochloride |
|---|---|
| PubChem CID | 2879638 |
| Molecular Formula | C22H30ClNO |
| Molecular Weight | 359.94 g/mol |
| Exact Mass | 359.20 |
| IUPAC Name | 3,4-dimethyl-2,6-diphenyl-5-propylpiperidin-4-ol;hydrochloride |
| SMILES | CCCC1C(c2ccccc2)NC(c2ccccc2)C(C)C1(C)O.Cl |
| InChI | InChI=1S/C22H29NO.ClH/c1-4-11-19-21(18-14-9-6-10-15-18)23-20(16(2)22(19,3)24)17-12-7-5-8-13-17;/h5-10,12-16,19-21,23-24H,4,11H2,1-3H3;1H |
| InChIKey | OLXMBCGTGWIZEW-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.94 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |