About 1-cycloheptyl-4-[[2-(trifluoromethyl)phenyl]methyl]piperazine;oxalic acid
1-cycloheptyl-4-[[2-(trifluoromethyl)phenyl]methyl]piperazine;oxalic acid (PubChem CID 2879928) has the molecular formula C21H29F3N2O4
and a molecular weight of 430.47 g/mol. Its IUPAC name is 1-cycloheptyl-4-[[2-(trifluoromethyl)phenyl]methyl]piperazine;oxalic acid.
Molecular Properties
| Compound Name | 1-cycloheptyl-4-[[2-(trifluoromethyl)phenyl]methyl]piperazine;oxalic acid |
| PubChem CID | 2879928 |
| Molecular Formula | C21H29F3N2O4 |
| Molecular Weight | 430.47 g/mol |
| Exact Mass | 430.21 |
| IUPAC Name | 1-cycloheptyl-4-[[2-(trifluoromethyl)phenyl]methyl]piperazine;oxalic acid |
| SMILES | FC(F)(F)c1ccccc1CN1CCN(C2CCCCCC2)CC1.O=C(O)C(=O)O |
| InChI | InChI=1S/C19H27F3N2.C2H2O4/c20-19(21,22)18-10-6-5-7-16(18)15-23-11-13-24(14-12-23)17-8-3-1-2-4-9-17;3-1(4)2(5)6/h5-7,10,17H,1-4,8-9,11-15H2;(H,3,4)(H,5,6) |
| InChIKey | GBTQSZDUJBHYHX-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 430.47 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 1-cycloheptyl-4-[[2-(trifluoromethyl)phenyl]methyl]piperazine;oxalic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cycloheptyl-4-[[2-(trifluoromethyl)phenyl]methyl]piperazine;oxalic acid?
The IUPAC name of 1-cycloheptyl-4-[[2-(trifluoromethyl)phenyl]methyl]piperazine;oxalic acid (CID 2879928) is 1-cycloheptyl-4-[[2-(trifluoromethyl)phenyl]methyl]piperazine;oxalic acid.
What is the SMILES notation for 1-cycloheptyl-4-[[2-(trifluoromethyl)phenyl]methyl]piperazine;oxalic acid?
The canonical SMILES for 1-cycloheptyl-4-[[2-(trifluoromethyl)phenyl]methyl]piperazine;oxalic acid is FC(F)(F)c1ccccc1CN1CCN(C2CCCCCC2)CC1.O=C(O)C(=O)O.
What is the InChIKey of 1-cycloheptyl-4-[[2-(trifluoromethyl)phenyl]methyl]piperazine;oxalic acid?
The InChIKey is GBTQSZDUJBHYHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H27F3N2.C2H2O4/c20-19(21,22)18-10-6-5-7-16(18)15-23-11-13-24(14-12-23)17-8-3-1-2-4-9-17;3-1(4)2(5)6/h5-7,10,17H,1-4,8-9,11-15H2;(H,3,4)(H,5,6).
What are the key properties of 1-cycloheptyl-4-[[2-(trifluoromethyl)phenyl]methyl]piperazine;oxalic acid?
1-cycloheptyl-4-[[2-(trifluoromethyl)phenyl]methyl]piperazine;oxalic acid has a molecular weight of 430.47 g/mol, XLogP of 3.70, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cycloheptyl-4-[[2-(trifluoromethyl)phenyl]methyl]piperazine;oxalic acid is sourced from PubChem (CID 2879928), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).