C15H22N2O5S — CID 2880105
(4-butan-2-ylpiperazin-1-yl)-thiophen-2-ylmethanone;oxalic acid (PubChem CID 2880105) has the molecular formula C15H22N2O5S and a molecular weight of 342.42 g/mol. Its IUPAC name is (4-butan-2-ylpiperazin-1-yl)-thiophen-2-ylmethanone;oxalic acid.
| Compound Name | (4-butan-2-ylpiperazin-1-yl)-thiophen-2-ylmethanone;oxalic acid |
|---|---|
| PubChem CID | 2880105 |
| Molecular Formula | C15H22N2O5S |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | (4-butan-2-ylpiperazin-1-yl)-thiophen-2-ylmethanone;oxalic acid |
| SMILES | CCC(C)N1CCN(C(=O)c2cccs2)CC1.O=C(O)C(=O)O |
| InChI | InChI=1S/C13H20N2OS.C2H2O4/c1-3-11(2)14-6-8-15(9-7-14)13(16)12-5-4-10-17-12;3-1(4)2(5)6/h4-5,10-11H,3,6-9H2,1-2H3;(H,3,4)(H,5,6) |
| InChIKey | KPGQYLTVGZTRJB-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 98.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|