2-([1,2,4]triazolo[4,3-a]pyrimidin-3-yl)acetic acid

C7H6N4O2 — CID 28804511

IUPAC2-([1,2,4]triazolo[4,3-a]pyrimidin-3-yl)acetic acid
SMILESO=C(O)Cc1nnc2ncccn12
InChIInChI=1S/C7H6N4O2/c12-6(13)4-5-9-10-7-8-2-1-3-11(5)7/h1-3H,4H2,(H,12,13)
InChIKeyOPVNJXWPKWPWFN-UHFFFAOYSA-N
MW178.15 g/mol
LogP-0.25
Rot. Bonds2

About 2-([1,2,4]triazolo[4,3-a]pyrimidin-3-yl)acetic acid

2-([1,2,4]triazolo[4,3-a]pyrimidin-3-yl)acetic acid (PubChem CID 28804511) has the molecular formula C7H6N4O2 and a molecular weight of 178.15 g/mol. Its IUPAC name is 2-([1,2,4]triazolo[4,3-a]pyrimidin-3-yl)acetic acid.

Molecular Properties

Compound Name2-([1,2,4]triazolo[4,3-a]pyrimidin-3-yl)acetic acid
PubChem CID28804511
Molecular FormulaC7H6N4O2
Molecular Weight178.15 g/mol
Exact Mass178.05
IUPAC Name2-([1,2,4]triazolo[4,3-a]pyrimidin-3-yl)acetic acid
SMILESO=C(O)Cc1nnc2ncccn12
InChIInChI=1S/C7H6N4O2/c12-6(13)4-5-9-10-7-8-2-1-3-11(5)7/h1-3H,4H2,(H,12,13)
InChIKeyOPVNJXWPKWPWFN-UHFFFAOYSA-N
XLogP-0.25
TPSA80.38 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds2
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500178.15
LogP ≤ 5-0.25
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze 2-([1,2,4]triazolo[4,3-a]pyrimidin-3-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-([1,2,4]triazolo[4,3-a]pyrimidin-3-yl)acetic acid?
The IUPAC name of 2-([1,2,4]triazolo[4,3-a]pyrimidin-3-yl)acetic acid (CID 28804511) is 2-([1,2,4]triazolo[4,3-a]pyrimidin-3-yl)acetic acid.
What is the SMILES notation for 2-([1,2,4]triazolo[4,3-a]pyrimidin-3-yl)acetic acid?
The canonical SMILES for 2-([1,2,4]triazolo[4,3-a]pyrimidin-3-yl)acetic acid is O=C(O)Cc1nnc2ncccn12.
What is the InChIKey of 2-([1,2,4]triazolo[4,3-a]pyrimidin-3-yl)acetic acid?
The InChIKey is OPVNJXWPKWPWFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N4O2/c12-6(13)4-5-9-10-7-8-2-1-3-11(5)7/h1-3H,4H2,(H,12,13).
What are the key properties of 2-([1,2,4]triazolo[4,3-a]pyrimidin-3-yl)acetic acid?
2-([1,2,4]triazolo[4,3-a]pyrimidin-3-yl)acetic acid has a molecular weight of 178.15 g/mol, XLogP of -0.25, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-([1,2,4]triazolo[4,3-a]pyrimidin-3-yl)acetic acid is sourced from PubChem (CID 28804511), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).