C11H15FN2 — CID 28804930
(2S)-2-(2-fluorophenyl)-1-methylpiperazine (PubChem CID 28804930) has the molecular formula C11H15FN2 and a molecular weight of 194.25 g/mol. Its IUPAC name is (2S)-2-(2-fluorophenyl)-1-methylpiperazine.
| Compound Name | (2S)-2-(2-fluorophenyl)-1-methylpiperazine |
|---|---|
| PubChem CID | 28804930 |
| Molecular Formula | C11H15FN2 |
| Molecular Weight | 194.25 g/mol |
| Exact Mass | 194.12 |
| IUPAC Name | (2S)-2-(2-fluorophenyl)-1-methylpiperazine |
| SMILES | CN1CCNC[C@@H]1c1ccccc1F |
| InChI | InChI=1S/C11H15FN2/c1-14-7-6-13-8-11(14)9-4-2-3-5-10(9)12/h2-5,11,13H,6-8H2,1H3/t11-/m1/s1 |
| InChIKey | XDEGAOYPBFQQAL-LLVKDONJSA-N |
| XLogP | 1.40 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.25 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |