C15H16N6O5S — CID 2880528
2-(1,3-dimethyl-2,6-dioxopurin-7-yl)-N-(4-sulfamoylphenyl)acetamide (PubChem CID 2880528) has the molecular formula C15H16N6O5S and a molecular weight of 392.40 g/mol. Its IUPAC name is 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)-N-(4-sulfamoylphenyl)acetamide.
| Compound Name | 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)-N-(4-sulfamoylphenyl)acetamide |
|---|---|
| PubChem CID | 2880528 |
| Molecular Formula | C15H16N6O5S |
| Molecular Weight | 392.40 g/mol |
| Exact Mass | 392.09 |
| IUPAC Name | 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)-N-(4-sulfamoylphenyl)acetamide |
| SMILES | Cn1c(=O)c2c(ncn2CC(=O)Nc2ccc(S(N)(=O)=O)cc2)n(C)c1=O |
| InChI | InChI=1S/C15H16N6O5S/c1-19-13-12(14(23)20(2)15(19)24)21(8-17-13)7-11(22)18-9-3-5-10(6-4-9)27(16,25)26/h3-6,8H,7H2,1-2H3,(H,18,22)(H2,16,25,26) |
| InChIKey | TYMMYRXZAZTECB-UHFFFAOYSA-N |
| XLogP | -1.28 |
| TPSA | 151.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.40 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |