About 5-amino-4-(2,5-dimethoxyphenyl)-3H-1,3-thiazole-2-thione
5-amino-4-(2,5-dimethoxyphenyl)-3H-1,3-thiazole-2-thione (PubChem CID 28805735) has the molecular formula C11H12N2O2S2
and a molecular weight of 268.36 g/mol. Its IUPAC name is 5-amino-4-(2,5-dimethoxyphenyl)-3H-1,3-thiazole-2-thione.
Molecular Properties
| Compound Name | 5-amino-4-(2,5-dimethoxyphenyl)-3H-1,3-thiazole-2-thione |
| PubChem CID | 28805735 |
| Molecular Formula | C11H12N2O2S2 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.03 |
| IUPAC Name | 5-amino-4-(2,5-dimethoxyphenyl)-3H-1,3-thiazole-2-thione |
| SMILES | COc1ccc(OC)c(-c2[nH]c(=S)sc2N)c1 |
| InChI | InChI=1S/C11H12N2O2S2/c1-14-6-3-4-8(15-2)7(5-6)9-10(12)17-11(16)13-9/h3-5H,12H2,1-2H3,(H,13,16) |
| InChIKey | CPPFENZAQCAINB-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 60.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 5-amino-4-(2,5-dimethoxyphenyl)-3H-1,3-thiazole-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-4-(2,5-dimethoxyphenyl)-3H-1,3-thiazole-2-thione?
The IUPAC name of 5-amino-4-(2,5-dimethoxyphenyl)-3H-1,3-thiazole-2-thione (CID 28805735) is 5-amino-4-(2,5-dimethoxyphenyl)-3H-1,3-thiazole-2-thione.
What is the SMILES notation for 5-amino-4-(2,5-dimethoxyphenyl)-3H-1,3-thiazole-2-thione?
The canonical SMILES for 5-amino-4-(2,5-dimethoxyphenyl)-3H-1,3-thiazole-2-thione is COc1ccc(OC)c(-c2[nH]c(=S)sc2N)c1.
What is the InChIKey of 5-amino-4-(2,5-dimethoxyphenyl)-3H-1,3-thiazole-2-thione?
The InChIKey is CPPFENZAQCAINB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N2O2S2/c1-14-6-3-4-8(15-2)7(5-6)9-10(12)17-11(16)13-9/h3-5H,12H2,1-2H3,(H,13,16).
What are the key properties of 5-amino-4-(2,5-dimethoxyphenyl)-3H-1,3-thiazole-2-thione?
5-amino-4-(2,5-dimethoxyphenyl)-3H-1,3-thiazole-2-thione has a molecular weight of 268.36 g/mol, XLogP of 3.07, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-4-(2,5-dimethoxyphenyl)-3H-1,3-thiazole-2-thione is sourced from PubChem (CID 28805735), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).