About 6-ethyl-3,4-dihydro-2H-1,4-benzoxazine
6-ethyl-3,4-dihydro-2H-1,4-benzoxazine (PubChem CID 28806805) has the molecular formula C10H13NO
and a molecular weight of 163.22 g/mol. Its IUPAC name is 6-ethyl-3,4-dihydro-2H-1,4-benzoxazine.
Molecular Properties
| Compound Name | 6-ethyl-3,4-dihydro-2H-1,4-benzoxazine |
| PubChem CID | 28806805 |
| Molecular Formula | C10H13NO |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.10 |
| IUPAC Name | 6-ethyl-3,4-dihydro-2H-1,4-benzoxazine |
| SMILES | CCc1ccc2c(c1)NCCO2 |
| InChI | InChI=1S/C10H13NO/c1-2-8-3-4-10-9(7-8)11-5-6-12-10/h3-4,7,11H,2,5-6H2,1H3 |
| InChIKey | SQIOKIUOUDQCCQ-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-ethyl-3,4-dihydro-2H-1,4-benzoxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethyl-3,4-dihydro-2H-1,4-benzoxazine?
The IUPAC name of 6-ethyl-3,4-dihydro-2H-1,4-benzoxazine (CID 28806805) is 6-ethyl-3,4-dihydro-2H-1,4-benzoxazine.
What is the SMILES notation for 6-ethyl-3,4-dihydro-2H-1,4-benzoxazine?
The canonical SMILES for 6-ethyl-3,4-dihydro-2H-1,4-benzoxazine is CCc1ccc2c(c1)NCCO2.
What is the InChIKey of 6-ethyl-3,4-dihydro-2H-1,4-benzoxazine?
The InChIKey is SQIOKIUOUDQCCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO/c1-2-8-3-4-10-9(7-8)11-5-6-12-10/h3-4,7,11H,2,5-6H2,1H3.
What are the key properties of 6-ethyl-3,4-dihydro-2H-1,4-benzoxazine?
6-ethyl-3,4-dihydro-2H-1,4-benzoxazine has a molecular weight of 163.22 g/mol, XLogP of 2.05, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethyl-3,4-dihydro-2H-1,4-benzoxazine is sourced from PubChem (CID 28806805), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).