2-[5-(furan-2-yl)-1,2-oxazol-3-yl]acetic acid

C9H7NO4 — CID 28808515

IUPAC2-[5-(furan-2-yl)-1,2-oxazol-3-yl]acetic acid
SMILESO=C(O)Cc1cc(-c2ccco2)on1
InChIInChI=1S/C9H7NO4/c11-9(12)5-6-4-8(14-10-6)7-2-1-3-13-7/h1-4H,5H2,(H,11,12)
InChIKeySHXLZAKTRKUOAP-UHFFFAOYSA-N
MW193.16 g/mol
LogP1.56
Rot. Bonds3

About 2-[5-(furan-2-yl)-1,2-oxazol-3-yl]acetic acid

2-[5-(furan-2-yl)-1,2-oxazol-3-yl]acetic acid (PubChem CID 28808515) has the molecular formula C9H7NO4 and a molecular weight of 193.16 g/mol. Its IUPAC name is 2-[5-(furan-2-yl)-1,2-oxazol-3-yl]acetic acid.

Molecular Properties

Compound Name2-[5-(furan-2-yl)-1,2-oxazol-3-yl]acetic acid
PubChem CID28808515
Molecular FormulaC9H7NO4
Molecular Weight193.16 g/mol
Exact Mass193.04
IUPAC Name2-[5-(furan-2-yl)-1,2-oxazol-3-yl]acetic acid
SMILESO=C(O)Cc1cc(-c2ccco2)on1
InChIInChI=1S/C9H7NO4/c11-9(12)5-6-4-8(14-10-6)7-2-1-3-13-7/h1-4H,5H2,(H,11,12)
InChIKeySHXLZAKTRKUOAP-UHFFFAOYSA-N
XLogP1.56
TPSA76.47 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500193.16
LogP ≤ 51.56
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 2-[5-(furan-2-yl)-1,2-oxazol-3-yl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[5-(furan-2-yl)-1,2-oxazol-3-yl]acetic acid?
The IUPAC name of 2-[5-(furan-2-yl)-1,2-oxazol-3-yl]acetic acid (CID 28808515) is 2-[5-(furan-2-yl)-1,2-oxazol-3-yl]acetic acid.
What is the SMILES notation for 2-[5-(furan-2-yl)-1,2-oxazol-3-yl]acetic acid?
The canonical SMILES for 2-[5-(furan-2-yl)-1,2-oxazol-3-yl]acetic acid is O=C(O)Cc1cc(-c2ccco2)on1.
What is the InChIKey of 2-[5-(furan-2-yl)-1,2-oxazol-3-yl]acetic acid?
The InChIKey is SHXLZAKTRKUOAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7NO4/c11-9(12)5-6-4-8(14-10-6)7-2-1-3-13-7/h1-4H,5H2,(H,11,12).
What are the key properties of 2-[5-(furan-2-yl)-1,2-oxazol-3-yl]acetic acid?
2-[5-(furan-2-yl)-1,2-oxazol-3-yl]acetic acid has a molecular weight of 193.16 g/mol, XLogP of 1.56, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-(furan-2-yl)-1,2-oxazol-3-yl]acetic acid is sourced from PubChem (CID 28808515), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).