C21H18O8S3 — CID 2880857
tetramethyl 10-phenyl-1,4,8-trithiaspiro[4.5]deca-2,6,9-triene-2,3,6,7-tetracarboxylate (PubChem CID 2880857) has the molecular formula C21H18O8S3 and a molecular weight of 494.57 g/mol. Its IUPAC name is tetramethyl 10-phenyl-1,4,8-trithiaspiro[4.5]deca-2,6,9-triene-2,3,6,7-tetracarboxylate.
| Compound Name | tetramethyl 10-phenyl-1,4,8-trithiaspiro[4.5]deca-2,6,9-triene-2,3,6,7-tetracarboxylate |
|---|---|
| PubChem CID | 2880857 |
| Molecular Formula | C21H18O8S3 |
| Molecular Weight | 494.57 g/mol |
| Exact Mass | 494.02 |
| IUPAC Name | tetramethyl 10-phenyl-1,4,8-trithiaspiro[4.5]deca-2,6,9-triene-2,3,6,7-tetracarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)SC2(S1)C(c1ccccc1)=CSC(C(=O)OC)=C2C(=O)OC |
| InChI | InChI=1S/C21H18O8S3/c1-26-17(22)13-14(18(23)27-2)30-10-12(11-8-6-5-7-9-11)21(13)31-15(19(24)28-3)16(32-21)20(25)29-4/h5-10H,1-4H3 |
| InChIKey | OLXASILZWBELNZ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.57 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|