C14H15NO6 — CID 28811113
(Z)-4-[4-(2-methoxyethoxycarbonyl)anilino]-4-oxobut-2-enoic acid (PubChem CID 28811113) has the molecular formula C14H15NO6 and a molecular weight of 293.28 g/mol. Its IUPAC name is (Z)-4-[4-(2-methoxyethoxycarbonyl)anilino]-4-oxobut-2-enoic acid.
| Compound Name | (Z)-4-[4-(2-methoxyethoxycarbonyl)anilino]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 28811113 |
| Molecular Formula | C14H15NO6 |
| Molecular Weight | 293.28 g/mol |
| Exact Mass | 293.09 |
| IUPAC Name | (Z)-4-[4-(2-methoxyethoxycarbonyl)anilino]-4-oxobut-2-enoic acid |
| SMILES | COCCOC(=O)c1ccc(NC(=O)/C=C\C(=O)O)cc1 |
| InChI | InChI=1S/C14H15NO6/c1-20-8-9-21-14(19)10-2-4-11(5-3-10)15-12(16)6-7-13(17)18/h2-7H,8-9H2,1H3,(H,15,16)(H,17,18)/b7-6- |
| InChIKey | LFFVPMVFENSGJM-SREVYHEPSA-N |
| XLogP | 1.07 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.28 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|