C16H15N3O3S2 — CID 2881120
4-[3-methyl-4-[(5-methylthiophen-2-yl)methylidene]-5-oxopyrazol-1-yl]benzenesulfonamide (PubChem CID 2881120) has the molecular formula C16H15N3O3S2 and a molecular weight of 361.45 g/mol. Its IUPAC name is 4-[3-methyl-4-[(5-methylthiophen-2-yl)methylidene]-5-oxopyrazol-1-yl]benzenesulfonamide.
| Compound Name | 4-[3-methyl-4-[(5-methylthiophen-2-yl)methylidene]-5-oxopyrazol-1-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 2881120 |
| Molecular Formula | C16H15N3O3S2 |
| Molecular Weight | 361.45 g/mol |
| Exact Mass | 361.06 |
| IUPAC Name | 4-[3-methyl-4-[(5-methylthiophen-2-yl)methylidene]-5-oxopyrazol-1-yl]benzenesulfonamide |
| SMILES | CC1=NN(c2ccc(S(N)(=O)=O)cc2)C(=O)C1=Cc1ccc(C)s1 |
| InChI | InChI=1S/C16H15N3O3S2/c1-10-3-6-13(23-10)9-15-11(2)18-19(16(15)20)12-4-7-14(8-5-12)24(17,21)22/h3-9H,1-2H3,(H2,17,21,22) |
| InChIKey | JNGCXUATWMWFMK-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 92.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.45 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|