C10H8ClNS2 — CID 28811345
5-[(2-chlorophenyl)methyl]-3H-1,3-thiazole-2-thione (PubChem CID 28811345) has the molecular formula C10H8ClNS2 and a molecular weight of 241.77 g/mol. Its IUPAC name is 5-[(2-chlorophenyl)methyl]-3H-1,3-thiazole-2-thione.
| Compound Name | 5-[(2-chlorophenyl)methyl]-3H-1,3-thiazole-2-thione |
|---|---|
| PubChem CID | 28811345 |
| Molecular Formula | C10H8ClNS2 |
| Molecular Weight | 241.77 g/mol |
| Exact Mass | 240.98 |
| IUPAC Name | 5-[(2-chlorophenyl)methyl]-3H-1,3-thiazole-2-thione |
| SMILES | S=c1[nH]cc(Cc2ccccc2Cl)s1 |
| InChI | InChI=1S/C10H8ClNS2/c11-9-4-2-1-3-7(9)5-8-6-12-10(13)14-8/h1-4,6H,5H2,(H,12,13) |
| InChIKey | PKOXWJAHVCOJSA-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.77 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|