About 1-ethyl-2,4,5-trimethylbenzene
1-ethyl-2,4,5-trimethylbenzene (PubChem CID 28812) has the molecular formula C11H16
and a molecular weight of 148.25 g/mol. Its IUPAC name is 1-ethyl-2,4,5-trimethylbenzene.
Molecular Properties
| Compound Name | 1-ethyl-2,4,5-trimethylbenzene |
| PubChem CID | 28812 |
| Molecular Formula | C11H16 |
| Molecular Weight | 148.25 g/mol |
| Exact Mass | 148.13 |
| IUPAC Name | 1-ethyl-2,4,5-trimethylbenzene |
| SMILES | CCc1cc(C)c(C)cc1C |
| InChI | InChI=1S/C11H16/c1-5-11-7-9(3)8(2)6-10(11)4/h6-7H,5H2,1-4H3 |
| InChIKey | IYFUQKGDILUVJG-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.25 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-ethyl-2,4,5-trimethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-2,4,5-trimethylbenzene?
The IUPAC name of 1-ethyl-2,4,5-trimethylbenzene (CID 28812) is 1-ethyl-2,4,5-trimethylbenzene.
What is the SMILES notation for 1-ethyl-2,4,5-trimethylbenzene?
The canonical SMILES for 1-ethyl-2,4,5-trimethylbenzene is CCc1cc(C)c(C)cc1C.
What is the InChIKey of 1-ethyl-2,4,5-trimethylbenzene?
The InChIKey is IYFUQKGDILUVJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16/c1-5-11-7-9(3)8(2)6-10(11)4/h6-7H,5H2,1-4H3.
What are the key properties of 1-ethyl-2,4,5-trimethylbenzene?
1-ethyl-2,4,5-trimethylbenzene has a molecular weight of 148.25 g/mol, XLogP of 3.17, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-2,4,5-trimethylbenzene is sourced from PubChem (CID 28812), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).