C18H15N3O4 — CID 2881346
5-benzoyl-6-methyl-4-(3-nitrophenyl)-3,4-dihydro-1H-pyrimidin-2-one (PubChem CID 2881346) has the molecular formula C18H15N3O4 and a molecular weight of 337.33 g/mol. Its IUPAC name is 5-benzoyl-6-methyl-4-(3-nitrophenyl)-3,4-dihydro-1H-pyrimidin-2-one.
| Compound Name | 5-benzoyl-6-methyl-4-(3-nitrophenyl)-3,4-dihydro-1H-pyrimidin-2-one |
|---|---|
| PubChem CID | 2881346 |
| Molecular Formula | C18H15N3O4 |
| Molecular Weight | 337.33 g/mol |
| Exact Mass | 337.11 |
| IUPAC Name | 5-benzoyl-6-methyl-4-(3-nitrophenyl)-3,4-dihydro-1H-pyrimidin-2-one |
| SMILES | CC1=C(C(=O)c2ccccc2)C(c2cccc([N+](=O)[O-])c2)NC(=O)N1 |
| InChI | InChI=1S/C18H15N3O4/c1-11-15(17(22)12-6-3-2-4-7-12)16(20-18(23)19-11)13-8-5-9-14(10-13)21(24)25/h2-10,16H,1H3,(H2,19,20,23) |
| InChIKey | JDVZEATUSCXVGE-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.33 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|