C17H17BrN4O3 — CID 2881349
2-(3-ethyl-2-iminobenzimidazol-1-yl)-1-(3-nitrophenyl)ethanone;hydrobromide (PubChem CID 2881349) has the molecular formula C17H17BrN4O3 and a molecular weight of 405.25 g/mol. Its IUPAC name is 2-(3-ethyl-2-iminobenzimidazol-1-yl)-1-(3-nitrophenyl)ethanone;hydrobromide.
| Compound Name | 2-(3-ethyl-2-iminobenzimidazol-1-yl)-1-(3-nitrophenyl)ethanone;hydrobromide |
|---|---|
| PubChem CID | 2881349 |
| Molecular Formula | C17H17BrN4O3 |
| Molecular Weight | 405.25 g/mol |
| Exact Mass | 404.05 |
| IUPAC Name | 2-(3-ethyl-2-iminobenzimidazol-1-yl)-1-(3-nitrophenyl)ethanone;hydrobromide |
| SMILES | Br.[H]/N=c1\n(CC)c2ccccc2n1CC(=O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H16N4O3.BrH/c1-2-19-14-8-3-4-9-15(14)20(17(19)18)11-16(22)12-6-5-7-13(10-12)21(23)24;/h3-10,18H,2,11H2,1H3;1H/b18-17+; |
| InChIKey | RVWJLGAQILPJAM-ZAGWXBKKSA-N |
| XLogP | 3.31 |
| TPSA | 93.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.25 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|