C21H21NO3 — CID 2881355
8-methoxy-1',3',3'-trimethylspiro[chromene-2,2'-indole]-6-carbaldehyde (PubChem CID 2881355) has the molecular formula C21H21NO3 and a molecular weight of 335.40 g/mol. Its IUPAC name is 8-methoxy-1',3',3'-trimethylspiro[chromene-2,2'-indole]-6-carbaldehyde.
| Compound Name | 8-methoxy-1',3',3'-trimethylspiro[chromene-2,2'-indole]-6-carbaldehyde |
|---|---|
| PubChem CID | 2881355 |
| Molecular Formula | C21H21NO3 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | 8-methoxy-1',3',3'-trimethylspiro[chromene-2,2'-indole]-6-carbaldehyde |
| SMILES | COc1cc(C=O)cc2c1OC1(C=C2)N(C)c2ccccc2C1(C)C |
| InChI | InChI=1S/C21H21NO3/c1-20(2)16-7-5-6-8-17(16)22(3)21(20)10-9-15-11-14(13-23)12-18(24-4)19(15)25-21/h5-13H,1-4H3 |
| InChIKey | SOSWXHDRHCWCDK-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|