About 1-(3,4-dichlorophenyl)-2-(3-ethyl-2-iminobenzimidazol-1-yl)ethanone;hydrobromide
1-(3,4-dichlorophenyl)-2-(3-ethyl-2-iminobenzimidazol-1-yl)ethanone;hydrobromide (PubChem CID 2881439) has the molecular formula C17H16BrCl2N3O
and a molecular weight of 429.15 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-2-(3-ethyl-2-iminobenzimidazol-1-yl)ethanone;hydrobromide.
Molecular Properties
| Compound Name | 1-(3,4-dichlorophenyl)-2-(3-ethyl-2-iminobenzimidazol-1-yl)ethanone;hydrobromide |
| PubChem CID | 2881439 |
| Molecular Formula | C17H16BrCl2N3O |
| Molecular Weight | 429.15 g/mol |
| Exact Mass | 426.99 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-2-(3-ethyl-2-iminobenzimidazol-1-yl)ethanone;hydrobromide |
| SMILES | Br.[H]/N=c1\n(CC)c2ccccc2n1CC(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C17H15Cl2N3O.BrH/c1-2-21-14-5-3-4-6-15(14)22(17(21)20)10-16(23)11-7-8-12(18)13(19)9-11;/h3-9,20H,2,10H2,1H3;1H/b20-17+; |
| InChIKey | IJGLGSKUKWIYBH-SJEOTZHBSA-N |
| XLogP | 4.71 |
| TPSA | 50.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 429.15 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(3,4-dichlorophenyl)-2-(3-ethyl-2-iminobenzimidazol-1-yl)ethanone;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,4-dichlorophenyl)-2-(3-ethyl-2-iminobenzimidazol-1-yl)ethanone;hydrobromide?
The IUPAC name of 1-(3,4-dichlorophenyl)-2-(3-ethyl-2-iminobenzimidazol-1-yl)ethanone;hydrobromide (CID 2881439) is 1-(3,4-dichlorophenyl)-2-(3-ethyl-2-iminobenzimidazol-1-yl)ethanone;hydrobromide.
What is the SMILES notation for 1-(3,4-dichlorophenyl)-2-(3-ethyl-2-iminobenzimidazol-1-yl)ethanone;hydrobromide?
The canonical SMILES for 1-(3,4-dichlorophenyl)-2-(3-ethyl-2-iminobenzimidazol-1-yl)ethanone;hydrobromide is Br.[H]/N=c1\n(CC)c2ccccc2n1CC(=O)c1ccc(Cl)c(Cl)c1.
What is the InChIKey of 1-(3,4-dichlorophenyl)-2-(3-ethyl-2-iminobenzimidazol-1-yl)ethanone;hydrobromide?
The InChIKey is IJGLGSKUKWIYBH-SJEOTZHBSA-N. The full InChI is InChI=1S/C17H15Cl2N3O.BrH/c1-2-21-14-5-3-4-6-15(14)22(17(21)20)10-16(23)11-7-8-12(18)13(19)9-11;/h3-9,20H,2,10H2,1H3;1H/b20-17+;.
What are the key properties of 1-(3,4-dichlorophenyl)-2-(3-ethyl-2-iminobenzimidazol-1-yl)ethanone;hydrobromide?
1-(3,4-dichlorophenyl)-2-(3-ethyl-2-iminobenzimidazol-1-yl)ethanone;hydrobromide has a molecular weight of 429.15 g/mol, XLogP of 4.71, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,4-dichlorophenyl)-2-(3-ethyl-2-iminobenzimidazol-1-yl)ethanone;hydrobromide is sourced from PubChem (CID 2881439), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).