C22H30N2O7 — CID 2881442
1-[4-(cyclohex-3-en-1-ylmethyl)piperazin-1-yl]-2-(4-methoxyphenoxy)ethanone;oxalic acid (PubChem CID 2881442) has the molecular formula C22H30N2O7 and a molecular weight of 434.49 g/mol. Its IUPAC name is 1-[4-(cyclohex-3-en-1-ylmethyl)piperazin-1-yl]-2-(4-methoxyphenoxy)ethanone;oxalic acid.
| Compound Name | 1-[4-(cyclohex-3-en-1-ylmethyl)piperazin-1-yl]-2-(4-methoxyphenoxy)ethanone;oxalic acid |
|---|---|
| PubChem CID | 2881442 |
| Molecular Formula | C22H30N2O7 |
| Molecular Weight | 434.49 g/mol |
| Exact Mass | 434.21 |
| IUPAC Name | 1-[4-(cyclohex-3-en-1-ylmethyl)piperazin-1-yl]-2-(4-methoxyphenoxy)ethanone;oxalic acid |
| SMILES | COc1ccc(OCC(=O)N2CCN(CC3CC=CCC3)CC2)cc1.O=C(O)C(=O)O |
| InChI | InChI=1S/C20H28N2O3.C2H2O4/c1-24-18-7-9-19(10-8-18)25-16-20(23)22-13-11-21(12-14-22)15-17-5-3-2-4-6-17;3-1(4)2(5)6/h2-3,7-10,17H,4-6,11-16H2,1H3;(H,3,4)(H,5,6) |
| InChIKey | VVZTUQAHILDUNZ-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 116.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.49 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|