About 3-(4-fluorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-5-ol
3-(4-fluorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-5-ol (PubChem CID 2881538) has the molecular formula C10H7F4NO2
and a molecular weight of 249.16 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-5-ol.
Molecular Properties
| Compound Name | 3-(4-fluorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-5-ol |
| PubChem CID | 2881538 |
| Molecular Formula | C10H7F4NO2 |
| Molecular Weight | 249.16 g/mol |
| Exact Mass | 249.04 |
| IUPAC Name | 3-(4-fluorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-5-ol |
| SMILES | OC1(C(F)(F)F)CC(c2ccc(F)cc2)=NO1 |
| InChI | InChI=1S/C10H7F4NO2/c11-7-3-1-6(2-4-7)8-5-9(16,17-15-8)10(12,13)14/h1-4,16H,5H2 |
| InChIKey | FIIZCXABWYGMAX-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.16 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(4-fluorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-fluorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-5-ol?
The IUPAC name of 3-(4-fluorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-5-ol (CID 2881538) is 3-(4-fluorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-5-ol.
What is the SMILES notation for 3-(4-fluorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-5-ol?
The canonical SMILES for 3-(4-fluorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-5-ol is OC1(C(F)(F)F)CC(c2ccc(F)cc2)=NO1.
What is the InChIKey of 3-(4-fluorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-5-ol?
The InChIKey is FIIZCXABWYGMAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7F4NO2/c11-7-3-1-6(2-4-7)8-5-9(16,17-15-8)10(12,13)14/h1-4,16H,5H2.
What are the key properties of 3-(4-fluorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-5-ol?
3-(4-fluorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-5-ol has a molecular weight of 249.16 g/mol, XLogP of 2.20, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-fluorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-5-ol is sourced from PubChem (CID 2881538), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).