C20H28N2O3 — CID 28815482
1-[[(1R)-cyclohex-2-en-1-yl]methyl]-3-(2-methoxyphenyl)-1-[[(2S)-oxolan-2-yl]methyl]urea (PubChem CID 28815482) has the molecular formula C20H28N2O3 and a molecular weight of 344.45 g/mol. Its IUPAC name is 1-[[(1R)-cyclohex-2-en-1-yl]methyl]-3-(2-methoxyphenyl)-1-[[(2S)-oxolan-2-yl]methyl]urea.
| Compound Name | 1-[[(1R)-cyclohex-2-en-1-yl]methyl]-3-(2-methoxyphenyl)-1-[[(2S)-oxolan-2-yl]methyl]urea |
|---|---|
| PubChem CID | 28815482 |
| Molecular Formula | C20H28N2O3 |
| Molecular Weight | 344.45 g/mol |
| Exact Mass | 344.21 |
| IUPAC Name | 1-[[(1R)-cyclohex-2-en-1-yl]methyl]-3-(2-methoxyphenyl)-1-[[(2S)-oxolan-2-yl]methyl]urea |
| SMILES | COc1ccccc1NC(=O)N(C[C@H]1C=CCCC1)C[C@@H]1CCCO1 |
| InChI | InChI=1S/C20H28N2O3/c1-24-19-12-6-5-11-18(19)21-20(23)22(15-17-10-7-13-25-17)14-16-8-3-2-4-9-16/h3,5-6,8,11-12,16-17H,2,4,7,9-10,13-15H2,1H3,(H,21,23)/t16-,17-/m0/s1 |
| InChIKey | UKVHCMOIEBZOJB-IRXDYDNUSA-N |
| XLogP | 4.06 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.45 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|