About 7-amino-2,2-dimethyl-4-(3-phenylpropyl)-1,4-benzoxazin-3-one
7-amino-2,2-dimethyl-4-(3-phenylpropyl)-1,4-benzoxazin-3-one (PubChem CID 28815908) has the molecular formula C19H22N2O2
and a molecular weight of 310.40 g/mol. Its IUPAC name is 7-amino-2,2-dimethyl-4-(3-phenylpropyl)-1,4-benzoxazin-3-one.
Molecular Properties
| Compound Name | 7-amino-2,2-dimethyl-4-(3-phenylpropyl)-1,4-benzoxazin-3-one |
| PubChem CID | 28815908 |
| Molecular Formula | C19H22N2O2 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | 7-amino-2,2-dimethyl-4-(3-phenylpropyl)-1,4-benzoxazin-3-one |
| SMILES | CC1(C)Oc2cc(N)ccc2N(CCCc2ccccc2)C1=O |
| InChI | InChI=1S/C19H22N2O2/c1-19(2)18(22)21(12-6-9-14-7-4-3-5-8-14)16-11-10-15(20)13-17(16)23-19/h3-5,7-8,10-11,13H,6,9,12,20H2,1-2H3 |
| InChIKey | JXZXQVZRXWKFGE-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 7-amino-2,2-dimethyl-4-(3-phenylpropyl)-1,4-benzoxazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-amino-2,2-dimethyl-4-(3-phenylpropyl)-1,4-benzoxazin-3-one?
The IUPAC name of 7-amino-2,2-dimethyl-4-(3-phenylpropyl)-1,4-benzoxazin-3-one (CID 28815908) is 7-amino-2,2-dimethyl-4-(3-phenylpropyl)-1,4-benzoxazin-3-one.
What is the SMILES notation for 7-amino-2,2-dimethyl-4-(3-phenylpropyl)-1,4-benzoxazin-3-one?
The canonical SMILES for 7-amino-2,2-dimethyl-4-(3-phenylpropyl)-1,4-benzoxazin-3-one is CC1(C)Oc2cc(N)ccc2N(CCCc2ccccc2)C1=O.
What is the InChIKey of 7-amino-2,2-dimethyl-4-(3-phenylpropyl)-1,4-benzoxazin-3-one?
The InChIKey is JXZXQVZRXWKFGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22N2O2/c1-19(2)18(22)21(12-6-9-14-7-4-3-5-8-14)16-11-10-15(20)13-17(16)23-19/h3-5,7-8,10-11,13H,6,9,12,20H2,1-2H3.
What are the key properties of 7-amino-2,2-dimethyl-4-(3-phenylpropyl)-1,4-benzoxazin-3-one?
7-amino-2,2-dimethyl-4-(3-phenylpropyl)-1,4-benzoxazin-3-one has a molecular weight of 310.40 g/mol, XLogP of 3.41, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-amino-2,2-dimethyl-4-(3-phenylpropyl)-1,4-benzoxazin-3-one is sourced from PubChem (CID 28815908), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).