C16H23N3O3 — CID 28815943
2-(7-amino-2,2-dimethyl-3-oxo-1,4-benzoxazin-4-yl)-N,N-diethylacetamide (PubChem CID 28815943) has the molecular formula C16H23N3O3 and a molecular weight of 305.38 g/mol. Its IUPAC name is 2-(7-amino-2,2-dimethyl-3-oxo-1,4-benzoxazin-4-yl)-N,N-diethylacetamide.
| Compound Name | 2-(7-amino-2,2-dimethyl-3-oxo-1,4-benzoxazin-4-yl)-N,N-diethylacetamide |
|---|---|
| PubChem CID | 28815943 |
| Molecular Formula | C16H23N3O3 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.17 |
| IUPAC Name | 2-(7-amino-2,2-dimethyl-3-oxo-1,4-benzoxazin-4-yl)-N,N-diethylacetamide |
| SMILES | CCN(CC)C(=O)CN1C(=O)C(C)(C)Oc2cc(N)ccc21 |
| InChI | InChI=1S/C16H23N3O3/c1-5-18(6-2)14(20)10-19-12-8-7-11(17)9-13(12)22-16(3,4)15(19)21/h7-9H,5-6,10,17H2,1-4H3 |
| InChIKey | VELQAAHUNIWFQJ-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 75.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|