About N-(9,10-dioxoanthracen-2-yl)-2-pyridin-2-ylsulfanylacetamide
N-(9,10-dioxoanthracen-2-yl)-2-pyridin-2-ylsulfanylacetamide (PubChem CID 2881767) has the molecular formula C21H14N2O3S
and a molecular weight of 374.42 g/mol. Its IUPAC name is N-(9,10-dioxoanthracen-2-yl)-2-pyridin-2-ylsulfanylacetamide.
Molecular Properties
| Compound Name | N-(9,10-dioxoanthracen-2-yl)-2-pyridin-2-ylsulfanylacetamide |
| PubChem CID | 2881767 |
| Molecular Formula | C21H14N2O3S |
| Molecular Weight | 374.42 g/mol |
| Exact Mass | 374.07 |
| IUPAC Name | N-(9,10-dioxoanthracen-2-yl)-2-pyridin-2-ylsulfanylacetamide |
| SMILES | O=C(CSc1ccccn1)Nc1ccc2c(c1)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C21H14N2O3S/c24-18(12-27-19-7-3-4-10-22-19)23-13-8-9-16-17(11-13)21(26)15-6-2-1-5-14(15)20(16)25/h1-11H,12H2,(H,23,24) |
| InChIKey | ILCDHEBYNAUTNC-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.42 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|
Analyze N-(9,10-dioxoanthracen-2-yl)-2-pyridin-2-ylsulfanylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(9,10-dioxoanthracen-2-yl)-2-pyridin-2-ylsulfanylacetamide?
The IUPAC name of N-(9,10-dioxoanthracen-2-yl)-2-pyridin-2-ylsulfanylacetamide (CID 2881767) is N-(9,10-dioxoanthracen-2-yl)-2-pyridin-2-ylsulfanylacetamide.
What is the SMILES notation for N-(9,10-dioxoanthracen-2-yl)-2-pyridin-2-ylsulfanylacetamide?
The canonical SMILES for N-(9,10-dioxoanthracen-2-yl)-2-pyridin-2-ylsulfanylacetamide is O=C(CSc1ccccn1)Nc1ccc2c(c1)C(=O)c1ccccc1C2=O.
What is the InChIKey of N-(9,10-dioxoanthracen-2-yl)-2-pyridin-2-ylsulfanylacetamide?
The InChIKey is ILCDHEBYNAUTNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H14N2O3S/c24-18(12-27-19-7-3-4-10-22-19)23-13-8-9-16-17(11-13)21(26)15-6-2-1-5-14(15)20(16)25/h1-11H,12H2,(H,23,24).
What are the key properties of N-(9,10-dioxoanthracen-2-yl)-2-pyridin-2-ylsulfanylacetamide?
N-(9,10-dioxoanthracen-2-yl)-2-pyridin-2-ylsulfanylacetamide has a molecular weight of 374.42 g/mol, XLogP of 3.59, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(9,10-dioxoanthracen-2-yl)-2-pyridin-2-ylsulfanylacetamide is sourced from PubChem (CID 2881767), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).