C10H8N2O3 — CID 28819147
6-methyl-4,12-dioxa-2,5-diazatricyclo[7.4.0.03,7]trideca-1,3(7),5,8-tetraen-13-one (PubChem CID 28819147) has the molecular formula C10H8N2O3 and a molecular weight of 204.18 g/mol. Its IUPAC name is 6-methyl-4,12-dioxa-2,5-diazatricyclo[7.4.0.03,7]trideca-1,3(7),5,8-tetraen-13-one.
| Compound Name | 6-methyl-4,12-dioxa-2,5-diazatricyclo[7.4.0.03,7]trideca-1,3(7),5,8-tetraen-13-one |
|---|---|
| PubChem CID | 28819147 |
| Molecular Formula | C10H8N2O3 |
| Molecular Weight | 204.18 g/mol |
| Exact Mass | 204.05 |
| IUPAC Name | 6-methyl-4,12-dioxa-2,5-diazatricyclo[7.4.0.03,7]trideca-1,3(7),5,8-tetraen-13-one |
| SMILES | Cc1noc2nc3c(cc12)CCOC3=O |
| InChI | InChI=1S/C10H8N2O3/c1-5-7-4-6-2-3-14-10(13)8(6)11-9(7)15-12-5/h4H,2-3H2,1H3 |
| InChIKey | XOJJQEZKIJUHDQ-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.18 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |