About 2-(5-carbamoyl-2,4-dioxopyrimidin-1-yl)acetic acid
2-(5-carbamoyl-2,4-dioxopyrimidin-1-yl)acetic acid (PubChem CID 28819630) has the molecular formula C7H7N3O5
and a molecular weight of 213.15 g/mol. Its IUPAC name is 2-(5-carbamoyl-2,4-dioxopyrimidin-1-yl)acetic acid.
Molecular Properties
| Compound Name | 2-(5-carbamoyl-2,4-dioxopyrimidin-1-yl)acetic acid |
| PubChem CID | 28819630 |
| Molecular Formula | C7H7N3O5 |
| Molecular Weight | 213.15 g/mol |
| Exact Mass | 213.04 |
| IUPAC Name | 2-(5-carbamoyl-2,4-dioxopyrimidin-1-yl)acetic acid |
| SMILES | NC(=O)c1cn(CC(=O)O)c(=O)[nH]c1=O |
| InChI | InChI=1S/C7H7N3O5/c8-5(13)3-1-10(2-4(11)12)7(15)9-6(3)14/h1H,2H2,(H2,8,13)(H,11,12)(H,9,14,15) |
| InChIKey | XOCUBEHFERLZFJ-UHFFFAOYSA-N |
| XLogP | -2.28 |
| TPSA | 135.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.15 |
| LogP ≤ 5 | -2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(5-carbamoyl-2,4-dioxopyrimidin-1-yl)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-carbamoyl-2,4-dioxopyrimidin-1-yl)acetic acid?
The IUPAC name of 2-(5-carbamoyl-2,4-dioxopyrimidin-1-yl)acetic acid (CID 28819630) is 2-(5-carbamoyl-2,4-dioxopyrimidin-1-yl)acetic acid.
What is the SMILES notation for 2-(5-carbamoyl-2,4-dioxopyrimidin-1-yl)acetic acid?
The canonical SMILES for 2-(5-carbamoyl-2,4-dioxopyrimidin-1-yl)acetic acid is NC(=O)c1cn(CC(=O)O)c(=O)[nH]c1=O.
What is the InChIKey of 2-(5-carbamoyl-2,4-dioxopyrimidin-1-yl)acetic acid?
The InChIKey is XOCUBEHFERLZFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N3O5/c8-5(13)3-1-10(2-4(11)12)7(15)9-6(3)14/h1H,2H2,(H2,8,13)(H,11,12)(H,9,14,15).
What are the key properties of 2-(5-carbamoyl-2,4-dioxopyrimidin-1-yl)acetic acid?
2-(5-carbamoyl-2,4-dioxopyrimidin-1-yl)acetic acid has a molecular weight of 213.15 g/mol, XLogP of -2.28, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-carbamoyl-2,4-dioxopyrimidin-1-yl)acetic acid is sourced from PubChem (CID 28819630), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).