C7H12F3NO — CID 28820187
(3S)-3-amino-1,1,1-trifluoro-5-methylhexan-2-one (PubChem CID 28820187) has the molecular formula C7H12F3NO and a molecular weight of 183.17 g/mol. Its IUPAC name is (3S)-3-amino-1,1,1-trifluoro-5-methylhexan-2-one.
| Compound Name | (3S)-3-amino-1,1,1-trifluoro-5-methylhexan-2-one |
|---|---|
| PubChem CID | 28820187 |
| Molecular Formula | C7H12F3NO |
| Molecular Weight | 183.17 g/mol |
| Exact Mass | 183.09 |
| IUPAC Name | (3S)-3-amino-1,1,1-trifluoro-5-methylhexan-2-one |
| SMILES | CC(C)C[C@H](N)C(=O)C(F)(F)F |
| InChI | InChI=1S/C7H12F3NO/c1-4(2)3-5(11)6(12)7(8,9)10/h4-5H,3,11H2,1-2H3/t5-/m0/s1 |
| InChIKey | NCFDPYIGPNZWPD-YFKPBYRVSA-N |
| XLogP | 1.49 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.17 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |