C10H18F3NO — CID 28820430
(1S,2R,5R)-2-propoxy-5-(trifluoromethyl)cyclohexan-1-amine (PubChem CID 28820430) has the molecular formula C10H18F3NO and a molecular weight of 225.25 g/mol. Its IUPAC name is (1S,2R,5R)-2-propoxy-5-(trifluoromethyl)cyclohexan-1-amine.
| Compound Name | (1S,2R,5R)-2-propoxy-5-(trifluoromethyl)cyclohexan-1-amine |
|---|---|
| PubChem CID | 28820430 |
| Molecular Formula | C10H18F3NO |
| Molecular Weight | 225.25 g/mol |
| Exact Mass | 225.13 |
| IUPAC Name | (1S,2R,5R)-2-propoxy-5-(trifluoromethyl)cyclohexan-1-amine |
| SMILES | CCCO[C@@H]1CC[C@@H](C(F)(F)F)C[C@@H]1N |
| InChI | InChI=1S/C10H18F3NO/c1-2-5-15-9-4-3-7(6-8(9)14)10(11,12)13/h7-9H,2-6,14H2,1H3/t7-,8+,9-/m1/s1 |
| InChIKey | DPMIUWYTUBBRNQ-HRDYMLBCSA-N |
| XLogP | 2.47 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.25 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |