C9H13N5O — CID 28820446
[(6R)-6-amino-5,6,7,8-tetrahydroquinazolin-2-yl]urea (PubChem CID 28820446) has the molecular formula C9H13N5O and a molecular weight of 207.24 g/mol. Its IUPAC name is [(6R)-6-amino-5,6,7,8-tetrahydroquinazolin-2-yl]urea.
| Compound Name | [(6R)-6-amino-5,6,7,8-tetrahydroquinazolin-2-yl]urea |
|---|---|
| PubChem CID | 28820446 |
| Molecular Formula | C9H13N5O |
| Molecular Weight | 207.24 g/mol |
| Exact Mass | 207.11 |
| IUPAC Name | [(6R)-6-amino-5,6,7,8-tetrahydroquinazolin-2-yl]urea |
| SMILES | NC(=O)Nc1ncc2c(n1)CC[C@@H](N)C2 |
| InChI | InChI=1S/C9H13N5O/c10-6-1-2-7-5(3-6)4-12-9(13-7)14-8(11)15/h4,6H,1-3,10H2,(H3,11,12,13,14,15)/t6-/m1/s1 |
| InChIKey | SEIGVCFDRGXPHL-ZCFIWIBFSA-N |
| XLogP | -0.22 |
| TPSA | 106.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.24 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |