C23H31N3O2 — CID 28821718
(2R)-1-(3-hexyl-2-iminobenzimidazol-1-yl)-3-(4-methylphenoxy)propan-2-ol (PubChem CID 28821718) has the molecular formula C23H31N3O2 and a molecular weight of 381.52 g/mol. Its IUPAC name is (2R)-1-(3-hexyl-2-iminobenzimidazol-1-yl)-3-(4-methylphenoxy)propan-2-ol.
| Compound Name | (2R)-1-(3-hexyl-2-iminobenzimidazol-1-yl)-3-(4-methylphenoxy)propan-2-ol |
|---|---|
| PubChem CID | 28821718 |
| Molecular Formula | C23H31N3O2 |
| Molecular Weight | 381.52 g/mol |
| Exact Mass | 381.24 |
| IUPAC Name | (2R)-1-(3-hexyl-2-iminobenzimidazol-1-yl)-3-(4-methylphenoxy)propan-2-ol |
| SMILES | [H]/N=c1\n(CCCCCC)c2ccccc2n1C[C@@H](O)COc1ccc(C)cc1 |
| InChI | InChI=1S/C23H31N3O2/c1-3-4-5-8-15-25-21-9-6-7-10-22(21)26(23(25)24)16-19(27)17-28-20-13-11-18(2)12-14-20/h6-7,9-14,19,24,27H,3-5,8,15-17H2,1-2H3/b24-23+/t19-/m1/s1 |
| InChIKey | QBQNBRYSAGGFGD-FYTMPNSFSA-N |
| XLogP | 4.25 |
| TPSA | 63.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.52 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|