About 3-(3-methyl-2,4,5-trioxoimidazolidin-1-yl)propanethioamide
3-(3-methyl-2,4,5-trioxoimidazolidin-1-yl)propanethioamide (PubChem CID 28824690) has the molecular formula C7H9N3O3S
and a molecular weight of 215.23 g/mol. Its IUPAC name is 3-(3-methyl-2,4,5-trioxoimidazolidin-1-yl)propanethioamide.
Molecular Properties
| Compound Name | 3-(3-methyl-2,4,5-trioxoimidazolidin-1-yl)propanethioamide |
| PubChem CID | 28824690 |
| Molecular Formula | C7H9N3O3S |
| Molecular Weight | 215.23 g/mol |
| Exact Mass | 215.04 |
| IUPAC Name | 3-(3-methyl-2,4,5-trioxoimidazolidin-1-yl)propanethioamide |
| SMILES | CN1C(=O)C(=O)N(CCC(N)=S)C1=O |
| InChI | InChI=1S/C7H9N3O3S/c1-9-5(11)6(12)10(7(9)13)3-2-4(8)14/h2-3H2,1H3,(H2,8,14) |
| InChIKey | TXCBYAHFMIWGSG-UHFFFAOYSA-N |
| XLogP | -0.92 |
| TPSA | 83.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.23 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-(3-methyl-2,4,5-trioxoimidazolidin-1-yl)propanethioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-methyl-2,4,5-trioxoimidazolidin-1-yl)propanethioamide?
The IUPAC name of 3-(3-methyl-2,4,5-trioxoimidazolidin-1-yl)propanethioamide (CID 28824690) is 3-(3-methyl-2,4,5-trioxoimidazolidin-1-yl)propanethioamide.
What is the SMILES notation for 3-(3-methyl-2,4,5-trioxoimidazolidin-1-yl)propanethioamide?
The canonical SMILES for 3-(3-methyl-2,4,5-trioxoimidazolidin-1-yl)propanethioamide is CN1C(=O)C(=O)N(CCC(N)=S)C1=O.
What is the InChIKey of 3-(3-methyl-2,4,5-trioxoimidazolidin-1-yl)propanethioamide?
The InChIKey is TXCBYAHFMIWGSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N3O3S/c1-9-5(11)6(12)10(7(9)13)3-2-4(8)14/h2-3H2,1H3,(H2,8,14).
What are the key properties of 3-(3-methyl-2,4,5-trioxoimidazolidin-1-yl)propanethioamide?
3-(3-methyl-2,4,5-trioxoimidazolidin-1-yl)propanethioamide has a molecular weight of 215.23 g/mol, XLogP of -0.92, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-methyl-2,4,5-trioxoimidazolidin-1-yl)propanethioamide is sourced from PubChem (CID 28824690), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).