C15H14N2OS — CID 28825096
2-(2,3-dihydro-1H-inden-5-yloxy)pyridine-4-carbothioamide (PubChem CID 28825096) has the molecular formula C15H14N2OS and a molecular weight of 270.36 g/mol. Its IUPAC name is 2-(2,3-dihydro-1H-inden-5-yloxy)pyridine-4-carbothioamide.
| Compound Name | 2-(2,3-dihydro-1H-inden-5-yloxy)pyridine-4-carbothioamide |
|---|---|
| PubChem CID | 28825096 |
| Molecular Formula | C15H14N2OS |
| Molecular Weight | 270.36 g/mol |
| Exact Mass | 270.08 |
| IUPAC Name | 2-(2,3-dihydro-1H-inden-5-yloxy)pyridine-4-carbothioamide |
| SMILES | NC(=S)c1ccnc(Oc2ccc3c(c2)CCC3)c1 |
| InChI | InChI=1S/C15H14N2OS/c16-15(19)12-6-7-17-14(9-12)18-13-5-4-10-2-1-3-11(10)8-13/h4-9H,1-3H2,(H2,16,19) |
| InChIKey | NFUOGVSZUSXHFA-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.36 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|