C12H15N3O3 — CID 28826297
(3R)-1-(6-oxo-1H-pyridine-3-carbonyl)piperidine-3-carboxamide (PubChem CID 28826297) has the molecular formula C12H15N3O3 and a molecular weight of 249.27 g/mol. Its IUPAC name is (3R)-1-(6-oxo-1H-pyridine-3-carbonyl)piperidine-3-carboxamide.
| Compound Name | (3R)-1-(6-oxo-1H-pyridine-3-carbonyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 28826297 |
| Molecular Formula | C12H15N3O3 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.11 |
| IUPAC Name | (3R)-1-(6-oxo-1H-pyridine-3-carbonyl)piperidine-3-carboxamide |
| SMILES | NC(=O)[C@@H]1CCCN(C(=O)c2ccc(=O)[nH]c2)C1 |
| InChI | InChI=1S/C12H15N3O3/c13-11(17)9-2-1-5-15(7-9)12(18)8-3-4-10(16)14-6-8/h3-4,6,9H,1-2,5,7H2,(H2,13,17)(H,14,16)/t9-/m1/s1 |
| InChIKey | SPMSBMRBOBPCOC-SECBINFHSA-N |
| XLogP | -0.29 |
| TPSA | 96.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |