About 6-oxo-N-(2,2,2-trifluoroethyl)-1H-pyridine-3-carboxamide
6-oxo-N-(2,2,2-trifluoroethyl)-1H-pyridine-3-carboxamide (PubChem CID 28826333) has the molecular formula C8H7F3N2O2
and a molecular weight of 220.15 g/mol. Its IUPAC name is 6-oxo-N-(2,2,2-trifluoroethyl)-1H-pyridine-3-carboxamide.
Molecular Properties
| Compound Name | 6-oxo-N-(2,2,2-trifluoroethyl)-1H-pyridine-3-carboxamide |
| PubChem CID | 28826333 |
| Molecular Formula | C8H7F3N2O2 |
| Molecular Weight | 220.15 g/mol |
| Exact Mass | 220.05 |
| IUPAC Name | 6-oxo-N-(2,2,2-trifluoroethyl)-1H-pyridine-3-carboxamide |
| SMILES | O=C(NCC(F)(F)F)c1ccc(=O)[nH]c1 |
| InChI | InChI=1S/C8H7F3N2O2/c9-8(10,11)4-13-7(15)5-1-2-6(14)12-3-5/h1-3H,4H2,(H,12,14)(H,13,15) |
| InChIKey | ZYYKQDYTHUNYKR-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.15 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-oxo-N-(2,2,2-trifluoroethyl)-1H-pyridine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-oxo-N-(2,2,2-trifluoroethyl)-1H-pyridine-3-carboxamide?
The IUPAC name of 6-oxo-N-(2,2,2-trifluoroethyl)-1H-pyridine-3-carboxamide (CID 28826333) is 6-oxo-N-(2,2,2-trifluoroethyl)-1H-pyridine-3-carboxamide.
What is the SMILES notation for 6-oxo-N-(2,2,2-trifluoroethyl)-1H-pyridine-3-carboxamide?
The canonical SMILES for 6-oxo-N-(2,2,2-trifluoroethyl)-1H-pyridine-3-carboxamide is O=C(NCC(F)(F)F)c1ccc(=O)[nH]c1.
What is the InChIKey of 6-oxo-N-(2,2,2-trifluoroethyl)-1H-pyridine-3-carboxamide?
The InChIKey is ZYYKQDYTHUNYKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7F3N2O2/c9-8(10,11)4-13-7(15)5-1-2-6(14)12-3-5/h1-3H,4H2,(H,12,14)(H,13,15).
What are the key properties of 6-oxo-N-(2,2,2-trifluoroethyl)-1H-pyridine-3-carboxamide?
6-oxo-N-(2,2,2-trifluoroethyl)-1H-pyridine-3-carboxamide has a molecular weight of 220.15 g/mol, XLogP of 0.67, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-oxo-N-(2,2,2-trifluoroethyl)-1H-pyridine-3-carboxamide is sourced from PubChem (CID 28826333), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).