C17H32ClNO — CID 2882867
2-(1-adamantyl)-2-(2,2-dimethylpropylamino)ethanol;hydrochloride (PubChem CID 2882867) has the molecular formula C17H32ClNO and a molecular weight of 301.90 g/mol. Its IUPAC name is 2-(1-adamantyl)-2-(2,2-dimethylpropylamino)ethanol;hydrochloride.
| Compound Name | 2-(1-adamantyl)-2-(2,2-dimethylpropylamino)ethanol;hydrochloride |
|---|---|
| PubChem CID | 2882867 |
| Molecular Formula | C17H32ClNO |
| Molecular Weight | 301.90 g/mol |
| Exact Mass | 301.22 |
| IUPAC Name | 2-(1-adamantyl)-2-(2,2-dimethylpropylamino)ethanol;hydrochloride |
| SMILES | CC(C)(C)CNC(CO)C12CC3CC(CC(C3)C1)C2.Cl |
| InChI | InChI=1S/C17H31NO.ClH/c1-16(2,3)11-18-15(10-19)17-7-12-4-13(8-17)6-14(5-12)9-17;/h12-15,18-19H,4-11H2,1-3H3;1H |
| InChIKey | VFHQPLSGRWTVAS-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.90 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |