About N-(furan-2-ylmethyl)-4,5-dihydro-1,3-thiazol-2-amine
N-(furan-2-ylmethyl)-4,5-dihydro-1,3-thiazol-2-amine (PubChem CID 28829457) has the molecular formula C8H10N2OS
and a molecular weight of 182.25 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-4,5-dihydro-1,3-thiazol-2-amine.
Molecular Properties
| Compound Name | N-(furan-2-ylmethyl)-4,5-dihydro-1,3-thiazol-2-amine |
| PubChem CID | 28829457 |
| Molecular Formula | C8H10N2OS |
| Molecular Weight | 182.25 g/mol |
| Exact Mass | 182.05 |
| IUPAC Name | N-(furan-2-ylmethyl)-4,5-dihydro-1,3-thiazol-2-amine |
| SMILES | c1coc(CNC2=NCCS2)c1 |
| InChI | InChI=1S/C8H10N2OS/c1-2-7(11-4-1)6-10-8-9-3-5-12-8/h1-2,4H,3,5-6H2,(H,9,10) |
| InChIKey | KNFHTECZPWVOCW-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 37.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.25 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(furan-2-ylmethyl)-4,5-dihydro-1,3-thiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(furan-2-ylmethyl)-4,5-dihydro-1,3-thiazol-2-amine?
The IUPAC name of N-(furan-2-ylmethyl)-4,5-dihydro-1,3-thiazol-2-amine (CID 28829457) is N-(furan-2-ylmethyl)-4,5-dihydro-1,3-thiazol-2-amine.
What is the SMILES notation for N-(furan-2-ylmethyl)-4,5-dihydro-1,3-thiazol-2-amine?
The canonical SMILES for N-(furan-2-ylmethyl)-4,5-dihydro-1,3-thiazol-2-amine is c1coc(CNC2=NCCS2)c1.
What is the InChIKey of N-(furan-2-ylmethyl)-4,5-dihydro-1,3-thiazol-2-amine?
The InChIKey is KNFHTECZPWVOCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2OS/c1-2-7(11-4-1)6-10-8-9-3-5-12-8/h1-2,4H,3,5-6H2,(H,9,10).
What are the key properties of N-(furan-2-ylmethyl)-4,5-dihydro-1,3-thiazol-2-amine?
N-(furan-2-ylmethyl)-4,5-dihydro-1,3-thiazol-2-amine has a molecular weight of 182.25 g/mol, XLogP of 1.47, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(furan-2-ylmethyl)-4,5-dihydro-1,3-thiazol-2-amine is sourced from PubChem (CID 28829457), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).