C22H21F3N2O5S — CID 2882990
3-[2-(3,4-dimethoxyphenyl)ethyl]-4-oxo-2-[3-(trifluoromethyl)phenyl]imino-1,3-thiazinane-6-carboxylic acid (PubChem CID 2882990) has the molecular formula C22H21F3N2O5S and a molecular weight of 482.48 g/mol. Its IUPAC name is 3-[2-(3,4-dimethoxyphenyl)ethyl]-4-oxo-2-[3-(trifluoromethyl)phenyl]imino-1,3-thiazinane-6-carboxylic acid.
| Compound Name | 3-[2-(3,4-dimethoxyphenyl)ethyl]-4-oxo-2-[3-(trifluoromethyl)phenyl]imino-1,3-thiazinane-6-carboxylic acid |
|---|---|
| PubChem CID | 2882990 |
| Molecular Formula | C22H21F3N2O5S |
| Molecular Weight | 482.48 g/mol |
| Exact Mass | 482.11 |
| IUPAC Name | 3-[2-(3,4-dimethoxyphenyl)ethyl]-4-oxo-2-[3-(trifluoromethyl)phenyl]imino-1,3-thiazinane-6-carboxylic acid |
| SMILES | COc1ccc(CCN2C(=O)CC(C(=O)O)S/C2=N\c2cccc(C(F)(F)F)c2)cc1OC |
| InChI | InChI=1S/C22H21F3N2O5S/c1-31-16-7-6-13(10-17(16)32-2)8-9-27-19(28)12-18(20(29)30)33-21(27)26-15-5-3-4-14(11-15)22(23,24)25/h3-7,10-11,18H,8-9,12H2,1-2H3,(H,29,30)/b26-21- |
| InChIKey | OFOLTIGNXOOKLJ-QLYXXIJNSA-N |
| XLogP | 4.37 |
| TPSA | 88.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.48 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|