About 5-(4-chlorophenyl)-3-(3,4-dimethoxyphenyl)-2-(2-fluorophenyl)-3,4-dihydropyrazole
5-(4-chlorophenyl)-3-(3,4-dimethoxyphenyl)-2-(2-fluorophenyl)-3,4-dihydropyrazole (PubChem CID 2883138) has the molecular formula C23H20ClFN2O2
and a molecular weight of 410.88 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-3-(3,4-dimethoxyphenyl)-2-(2-fluorophenyl)-3,4-dihydropyrazole.
Molecular Properties
| Compound Name | 5-(4-chlorophenyl)-3-(3,4-dimethoxyphenyl)-2-(2-fluorophenyl)-3,4-dihydropyrazole |
| PubChem CID | 2883138 |
| Molecular Formula | C23H20ClFN2O2 |
| Molecular Weight | 410.88 g/mol |
| Exact Mass | 410.12 |
| IUPAC Name | 5-(4-chlorophenyl)-3-(3,4-dimethoxyphenyl)-2-(2-fluorophenyl)-3,4-dihydropyrazole |
| SMILES | COc1ccc(C2CC(c3ccc(Cl)cc3)=NN2c2ccccc2F)cc1OC |
| InChI | InChI=1S/C23H20ClFN2O2/c1-28-22-12-9-16(13-23(22)29-2)21-14-19(15-7-10-17(24)11-8-15)26-27(21)20-6-4-3-5-18(20)25/h3-13,21H,14H2,1-2H3 |
| InChIKey | UOANMYHLZNCCKC-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 410.88 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(4-chlorophenyl)-3-(3,4-dimethoxyphenyl)-2-(2-fluorophenyl)-3,4-dihydropyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-chlorophenyl)-3-(3,4-dimethoxyphenyl)-2-(2-fluorophenyl)-3,4-dihydropyrazole?
The IUPAC name of 5-(4-chlorophenyl)-3-(3,4-dimethoxyphenyl)-2-(2-fluorophenyl)-3,4-dihydropyrazole (CID 2883138) is 5-(4-chlorophenyl)-3-(3,4-dimethoxyphenyl)-2-(2-fluorophenyl)-3,4-dihydropyrazole.
What is the SMILES notation for 5-(4-chlorophenyl)-3-(3,4-dimethoxyphenyl)-2-(2-fluorophenyl)-3,4-dihydropyrazole?
The canonical SMILES for 5-(4-chlorophenyl)-3-(3,4-dimethoxyphenyl)-2-(2-fluorophenyl)-3,4-dihydropyrazole is COc1ccc(C2CC(c3ccc(Cl)cc3)=NN2c2ccccc2F)cc1OC.
What is the InChIKey of 5-(4-chlorophenyl)-3-(3,4-dimethoxyphenyl)-2-(2-fluorophenyl)-3,4-dihydropyrazole?
The InChIKey is UOANMYHLZNCCKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H20ClFN2O2/c1-28-22-12-9-16(13-23(22)29-2)21-14-19(15-7-10-17(24)11-8-15)26-27(21)20-6-4-3-5-18(20)25/h3-13,21H,14H2,1-2H3.
What are the key properties of 5-(4-chlorophenyl)-3-(3,4-dimethoxyphenyl)-2-(2-fluorophenyl)-3,4-dihydropyrazole?
5-(4-chlorophenyl)-3-(3,4-dimethoxyphenyl)-2-(2-fluorophenyl)-3,4-dihydropyrazole has a molecular weight of 410.88 g/mol, XLogP of 5.85, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-chlorophenyl)-3-(3,4-dimethoxyphenyl)-2-(2-fluorophenyl)-3,4-dihydropyrazole is sourced from PubChem (CID 2883138), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).